C25H28ClN5O6S2 — CID 15983996
5-chloro-N-[4-(dimethylamino)-2-[[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]carbamoyl]-5-methylphenyl]thiophene-2-carboxamide;methanesulfonic acid (PubChem CID 15983996) has the molecular formula C25H28ClN5O6S2 and a molecular weight of 594.12 g/mol. Its IUPAC name is 5-chloro-N-[4-(dimethylamino)-2-[[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]carbamoyl]-5-methylphenyl]thiophene-2-carboxamide;methanesulfonic acid.
| Compound Name | 5-chloro-N-[4-(dimethylamino)-2-[[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]carbamoyl]-5-methylphenyl]thiophene-2-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 15983996 |
| Molecular Formula | C25H28ClN5O6S2 |
| Molecular Weight | 594.12 g/mol |
| Exact Mass | 593.12 |
| IUPAC Name | 5-chloro-N-[4-(dimethylamino)-2-[[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]carbamoyl]-5-methylphenyl]thiophene-2-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.[H]/N=C1\OCCN1c1ccc(NC(=O)c2cc(N(C)C)c(C)cc2NC(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C24H24ClN5O3S.CH4O3S/c1-14-12-18(28-23(32)20-8-9-21(25)34-20)17(13-19(14)29(2)3)22(31)27-15-4-6-16(7-5-15)30-10-11-33-24(30)26;1-5(2,3)4/h4-9,12-13,26H,10-11H2,1-3H3,(H,27,31)(H,28,32);1H3,(H,2,3,4)/b26-24-; |
| InChIKey | OJPBKSHQYSMJKT-FSKGQQLBSA-N |
| XLogP | 4.56 |
| TPSA | 152.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.12 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|