C22H17ClN4O3S — CID 90796954
5-chloro-N-[1-hydroxy-2-[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]isoindol-4-yl]thiophene-2-carboxamide (PubChem CID 90796954) has the molecular formula C22H17ClN4O3S and a molecular weight of 452.92 g/mol. Its IUPAC name is 5-chloro-N-[1-hydroxy-2-[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]isoindol-4-yl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[1-hydroxy-2-[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]isoindol-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 90796954 |
| Molecular Formula | C22H17ClN4O3S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 5-chloro-N-[1-hydroxy-2-[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]isoindol-4-yl]thiophene-2-carboxamide |
| SMILES | [H]/N=C1\OCCN1c1ccc(-n2cc3c(NC(=O)c4ccc(Cl)s4)cccc3c2O)cc1 |
| InChI | InChI=1S/C22H17ClN4O3S/c23-19-9-8-18(31-19)20(28)25-17-3-1-2-15-16(17)12-27(21(15)29)14-6-4-13(5-7-14)26-10-11-30-22(26)24/h1-9,12,24,29H,10-11H2,(H,25,28)/b24-22- |
| InChIKey | BGPKKVYEJLSODZ-GYHWCHFESA-N |
| XLogP | 5.07 |
| TPSA | 90.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|