C21H18ClN5O6S2 — CID 90938937
[N-[4-[(5-chlorothiophene-2-carbonyl)amino]pyridine-3-carbonyl]-4-(2-imino-1,3-oxazolidin-3-yl)anilino]methanesulfonic acid (PubChem CID 90938937) has the molecular formula C21H18ClN5O6S2 and a molecular weight of 535.99 g/mol. Its IUPAC name is [N-[4-[(5-chlorothiophene-2-carbonyl)amino]pyridine-3-carbonyl]-4-(2-imino-1,3-oxazolidin-3-yl)anilino]methanesulfonic acid.
| Compound Name | [N-[4-[(5-chlorothiophene-2-carbonyl)amino]pyridine-3-carbonyl]-4-(2-imino-1,3-oxazolidin-3-yl)anilino]methanesulfonic acid |
|---|---|
| PubChem CID | 90938937 |
| Molecular Formula | C21H18ClN5O6S2 |
| Molecular Weight | 535.99 g/mol |
| Exact Mass | 535.04 |
| IUPAC Name | [N-[4-[(5-chlorothiophene-2-carbonyl)amino]pyridine-3-carbonyl]-4-(2-imino-1,3-oxazolidin-3-yl)anilino]methanesulfonic acid |
| SMILES | [H]/N=C1\OCCN1c1ccc(N(CS(=O)(=O)O)C(=O)c2cnccc2NC(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C21H18ClN5O6S2/c22-18-6-5-17(34-18)19(28)25-16-7-8-24-11-15(16)20(29)27(12-35(30,31)32)14-3-1-13(2-4-14)26-9-10-33-21(26)23/h1-8,11,23H,9-10,12H2,(H,24,25,28)(H,30,31,32)/b23-21- |
| InChIKey | XLTHNFYKVSSJFE-LNVKXUELSA-N |
| XLogP | 3.31 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.99 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|