C22H20ClN5O4S — CID 68714469
4-chloro-N-[4-[4-(2-imino-1,3-oxazolidin-3-yl)-N-methylsulfonylanilino]-3-pyridinyl]benzamide (PubChem CID 68714469) has the molecular formula C22H20ClN5O4S and a molecular weight of 485.95 g/mol. Its IUPAC name is 4-chloro-N-[4-[4-(2-imino-1,3-oxazolidin-3-yl)-N-methylsulfonylanilino]-3-pyridinyl]benzamide.
| Compound Name | 4-chloro-N-[4-[4-(2-imino-1,3-oxazolidin-3-yl)-N-methylsulfonylanilino]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 68714469 |
| Molecular Formula | C22H20ClN5O4S |
| Molecular Weight | 485.95 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 4-chloro-N-[4-[4-(2-imino-1,3-oxazolidin-3-yl)-N-methylsulfonylanilino]-3-pyridinyl]benzamide |
| SMILES | [H]/N=C1\OCCN1c1ccc(N(c2ccncc2NC(=O)c2ccc(Cl)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H20ClN5O4S/c1-33(30,31)28(18-8-6-17(7-9-18)27-12-13-32-22(27)24)20-10-11-25-14-19(20)26-21(29)15-2-4-16(23)5-3-15/h2-11,14,24H,12-13H2,1H3,(H,26,29)/b24-22- |
| InChIKey | JUEGQMHDEOYANB-GYHWCHFESA-N |
| XLogP | 3.86 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.95 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|