C24H20Cl2N4O6S — CID 91368165
[N-[4-chloro-2-[(4-chlorobenzoyl)amino]benzoyl]-4-(2-imino-1,3-oxazolidin-3-yl)anilino]methanesulfonic acid (PubChem CID 91368165) has the molecular formula C24H20Cl2N4O6S and a molecular weight of 563.42 g/mol. Its IUPAC name is [N-[4-chloro-2-[(4-chlorobenzoyl)amino]benzoyl]-4-(2-imino-1,3-oxazolidin-3-yl)anilino]methanesulfonic acid.
| Compound Name | [N-[4-chloro-2-[(4-chlorobenzoyl)amino]benzoyl]-4-(2-imino-1,3-oxazolidin-3-yl)anilino]methanesulfonic acid |
|---|---|
| PubChem CID | 91368165 |
| Molecular Formula | C24H20Cl2N4O6S |
| Molecular Weight | 563.42 g/mol |
| Exact Mass | 562.05 |
| IUPAC Name | [N-[4-chloro-2-[(4-chlorobenzoyl)amino]benzoyl]-4-(2-imino-1,3-oxazolidin-3-yl)anilino]methanesulfonic acid |
| SMILES | [H]/N=C1\OCCN1c1ccc(N(CS(=O)(=O)O)C(=O)c2ccc(Cl)cc2NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H20Cl2N4O6S/c25-16-3-1-15(2-4-16)22(31)28-21-13-17(26)5-10-20(21)23(32)30(14-37(33,34)35)19-8-6-18(7-9-19)29-11-12-36-24(29)27/h1-10,13,27H,11-12,14H2,(H,28,31)(H,33,34,35)/b27-24- |
| InChIKey | DIKXSVIMZCGTTJ-PNHLSOANSA-N |
| XLogP | 4.51 |
| TPSA | 140.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|