C21H19N5O3S — CID 89112353
N-[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]-2-[(5-methylthiophene-2-carbonyl)amino]pyridine-3-carboxamide (PubChem CID 89112353) has the molecular formula C21H19N5O3S and a molecular weight of 421.48 g/mol. Its IUPAC name is N-[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]-2-[(5-methylthiophene-2-carbonyl)amino]pyridine-3-carboxamide.
| Compound Name | N-[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]-2-[(5-methylthiophene-2-carbonyl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 89112353 |
| Molecular Formula | C21H19N5O3S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]-2-[(5-methylthiophene-2-carbonyl)amino]pyridine-3-carboxamide |
| SMILES | [H]/N=C1\OCCN1c1ccc(NC(=O)c2cccnc2NC(=O)c2ccc(C)s2)cc1 |
| InChI | InChI=1S/C21H19N5O3S/c1-13-4-9-17(30-13)20(28)25-18-16(3-2-10-23-18)19(27)24-14-5-7-15(8-6-14)26-11-12-29-21(26)22/h2-10,22H,11-12H2,1H3,(H,24,27)(H,23,25,28)/b22-21- |
| InChIKey | NHOADGVBHMGPAV-DQRAZIAOSA-N |
| XLogP | 3.73 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|