C37H39Cl2N3O5SSi — CID 68772092
N-[(2S)-3-[4-[3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-oxo-1-pyridinyl]-3-chloroanilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide (PubChem CID 68772092) has the molecular formula C37H39Cl2N3O5SSi and a molecular weight of 736.79 g/mol. Its IUPAC name is N-[(2S)-3-[4-[3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-oxo-1-pyridinyl]-3-chloroanilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[(2S)-3-[4-[3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-oxo-1-pyridinyl]-3-chloroanilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 68772092 |
| Molecular Formula | C37H39Cl2N3O5SSi |
| Molecular Weight | 736.79 g/mol |
| Exact Mass | 735.18 |
| IUPAC Name | N-[(2S)-3-[4-[3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-oxo-1-pyridinyl]-3-chloroanilino]-2-hydroxypropyl]-5-chlorothiophene-2-carboxamide |
| SMILES | CC(C)(C)[Si](OCCOc1cccn(-c2ccc(NC[C@H](O)CNC(=O)c3ccc(Cl)s3)cc2Cl)c1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H39Cl2N3O5SSi/c1-37(2,3)49(28-11-6-4-7-12-28,29-13-8-5-9-14-29)47-22-21-46-32-15-10-20-42(36(32)45)31-17-16-26(23-30(31)38)40-24-27(43)25-41-35(44)33-18-19-34(39)48-33/h4-20,23,27,40,43H,21-22,24-25H2,1-3H3,(H,41,44)/t27-/m0/s1 |
| InChIKey | WBHMJWBTAIEUDE-MHZLTWQESA-N |
| XLogP | 6.36 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.79 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|