C15H10Cl2N2O2S — CID 157073972
3-[3-(6-chloro-3-pyridinyl)-1,2-oxazol-5-yl]-1-(5-chlorothiophen-2-yl)propan-1-one (PubChem CID 157073972) has the molecular formula C15H10Cl2N2O2S and a molecular weight of 353.23 g/mol. Its IUPAC name is 3-[3-(6-chloro-3-pyridinyl)-1,2-oxazol-5-yl]-1-(5-chlorothiophen-2-yl)propan-1-one.
| Compound Name | 3-[3-(6-chloro-3-pyridinyl)-1,2-oxazol-5-yl]-1-(5-chlorothiophen-2-yl)propan-1-one |
|---|---|
| PubChem CID | 157073972 |
| Molecular Formula | C15H10Cl2N2O2S |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 3-[3-(6-chloro-3-pyridinyl)-1,2-oxazol-5-yl]-1-(5-chlorothiophen-2-yl)propan-1-one |
| SMILES | O=C(CCc1cc(-c2ccc(Cl)nc2)no1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H10Cl2N2O2S/c16-14-5-1-9(8-18-14)11-7-10(21-19-11)2-3-12(20)13-4-6-15(17)22-13/h1,4-8H,2-3H2 |
| InChIKey | NSWGWHUWOYNPBV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|