C21H23N5O2S — CID 143160679
5-ethyl-N-[[3-[4-(pyrrolidine-1-carboximidoyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]thiophene-2-carboxamide (PubChem CID 143160679) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is 5-ethyl-N-[[3-[4-(pyrrolidine-1-carboximidoyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-ethyl-N-[[3-[4-(pyrrolidine-1-carboximidoyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 143160679 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 5-ethyl-N-[[3-[4-(pyrrolidine-1-carboximidoyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]thiophene-2-carboxamide |
| SMILES | [H]/N=C(/c1ccc(-c2noc(CNC(=O)c3ccc(CC)s3)n2)cc1)N1CCCC1 |
| InChI | InChI=1S/C21H23N5O2S/c1-2-16-9-10-17(29-16)21(27)23-13-18-24-20(25-28-18)15-7-5-14(6-8-15)19(22)26-11-3-4-12-26/h5-10,22H,2-4,11-13H2,1H3,(H,23,27)/b22-19- |
| InChIKey | BSIQZAOKBGYZED-QOCHGBHMSA-N |
| XLogP | 3.71 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|