C21H23N3O2S2 — CID 89425107
S-[2-[(5-methylthiophene-2-carbonyl)amino]ethyl] 4-(2,5-dihydropyrrole-1-carboximidoyl)-2-methylbenzenecarbothioate (PubChem CID 89425107) has the molecular formula C21H23N3O2S2 and a molecular weight of 413.57 g/mol. Its IUPAC name is S-[2-[(5-methylthiophene-2-carbonyl)amino]ethyl] 4-(2,5-dihydropyrrole-1-carboximidoyl)-2-methylbenzenecarbothioate.
| Compound Name | S-[2-[(5-methylthiophene-2-carbonyl)amino]ethyl] 4-(2,5-dihydropyrrole-1-carboximidoyl)-2-methylbenzenecarbothioate |
|---|---|
| PubChem CID | 89425107 |
| Molecular Formula | C21H23N3O2S2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | S-[2-[(5-methylthiophene-2-carbonyl)amino]ethyl] 4-(2,5-dihydropyrrole-1-carboximidoyl)-2-methylbenzenecarbothioate |
| SMILES | [H]/N=C(/c1ccc(C(=O)SCCNC(=O)c2ccc(C)s2)c(C)c1)N1CC=CC1 |
| InChI | InChI=1S/C21H23N3O2S2/c1-14-13-16(19(22)24-10-3-4-11-24)6-7-17(14)21(26)27-12-9-23-20(25)18-8-5-15(2)28-18/h3-8,13,22H,9-12H2,1-2H3,(H,23,25)/b22-19- |
| InChIKey | CJSKMCMLWSVMNY-QOCHGBHMSA-N |
| XLogP | 3.87 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|