C21H22IN3O3S2 — CID 89425063
2-[[5-(iodomethyl)thiophene-2-carbonyl]amino]ethyl 4-(2,5-dihydropyrrole-1-carboximidoyl)-2-methylsulfanylbenzoate (PubChem CID 89425063) has the molecular formula C21H22IN3O3S2 and a molecular weight of 555.46 g/mol. Its IUPAC name is 2-[[5-(iodomethyl)thiophene-2-carbonyl]amino]ethyl 4-(2,5-dihydropyrrole-1-carboximidoyl)-2-methylsulfanylbenzoate.
| Compound Name | 2-[[5-(iodomethyl)thiophene-2-carbonyl]amino]ethyl 4-(2,5-dihydropyrrole-1-carboximidoyl)-2-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 89425063 |
| Molecular Formula | C21H22IN3O3S2 |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 555.01 |
| IUPAC Name | 2-[[5-(iodomethyl)thiophene-2-carbonyl]amino]ethyl 4-(2,5-dihydropyrrole-1-carboximidoyl)-2-methylsulfanylbenzoate |
| SMILES | [H]/N=C(/c1ccc(C(=O)OCCNC(=O)c2ccc(CI)s2)c(SC)c1)N1CC=CC1 |
| InChI | InChI=1S/C21H22IN3O3S2/c1-29-18-12-14(19(23)25-9-2-3-10-25)4-6-16(18)21(27)28-11-8-24-20(26)17-7-5-15(13-22)30-17/h2-7,12,23H,8-11,13H2,1H3,(H,24,26)/b23-19- |
| InChIKey | WLKDKOHTNHVDSC-NMWGTECJSA-N |
| XLogP | 4.19 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|