C18H21N4O2+ — CID 87605191
N-[[3-[4-[azetidin-1-ium-1-ylidene(azetidin-1-yl)methyl]phenyl]-1,2-oxazol-5-yl]methyl]formamide (PubChem CID 87605191) has the molecular formula C18H21N4O2+ and a molecular weight of 325.39 g/mol. Its IUPAC name is N-[[3-[4-[azetidin-1-ium-1-ylidene(azetidin-1-yl)methyl]phenyl]-1,2-oxazol-5-yl]methyl]formamide.
| Compound Name | N-[[3-[4-[azetidin-1-ium-1-ylidene(azetidin-1-yl)methyl]phenyl]-1,2-oxazol-5-yl]methyl]formamide |
|---|---|
| PubChem CID | 87605191 |
| Molecular Formula | C18H21N4O2+ |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | N-[[3-[4-[azetidin-1-ium-1-ylidene(azetidin-1-yl)methyl]phenyl]-1,2-oxazol-5-yl]methyl]formamide |
| SMILES | O=CNCc1cc(-c2ccc(C(N3CCC3)=[N+]3CCC3)cc2)no1 |
| InChI | InChI=1S/C18H20N4O2/c23-13-19-12-16-11-17(20-24-16)14-3-5-15(6-4-14)18(21-7-1-8-21)22-9-2-10-22/h3-6,11,13H,1-2,7-10,12H2/p+1 |
| InChIKey | ZIBXFNQOPMRLRE-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 61.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|