C17H18N2O2 — CID 71941652
2-cyclopent-2-en-1-yl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]acetamide (PubChem CID 71941652) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 71941652 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-[(3-phenyl-1,2-oxazol-5-yl)methyl]acetamide |
| SMILES | O=C(CC1C=CCC1)NCc1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C17H18N2O2/c20-17(10-13-6-4-5-7-13)18-12-15-11-16(19-21-15)14-8-2-1-3-9-14/h1-4,6,8-9,11,13H,5,7,10,12H2,(H,18,20) |
| InChIKey | LINQHAORLPOOMU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|