About [(E)-hex-3-en-3-yl] 3-methoxybenzenecarboximidate
[(E)-hex-3-en-3-yl] 3-methoxybenzenecarboximidate (PubChem CID 142936511) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is [(E)-hex-3-en-3-yl] 3-methoxybenzenecarboximidate.
Molecular Properties
| Compound Name | [(E)-hex-3-en-3-yl] 3-methoxybenzenecarboximidate |
| PubChem CID | 142936511 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | [(E)-hex-3-en-3-yl] 3-methoxybenzenecarboximidate |
| SMILES | [H]/N=C(\O/C(=C/CC)CC)c1cccc(OC)c1 |
| InChI | InChI=1S/C14H19NO2/c1-4-7-12(5-2)17-14(15)11-8-6-9-13(10-11)16-3/h6-10,15H,4-5H2,1-3H3/b12-7+,15-14- |
| InChIKey | YTADVUGITUKJSF-RQHVUCQOSA-N |
| XLogP | 3.74 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [(E)-hex-3-en-3-yl] 3-methoxybenzenecarboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-hex-3-en-3-yl] 3-methoxybenzenecarboximidate?
The IUPAC name of [(E)-hex-3-en-3-yl] 3-methoxybenzenecarboximidate (CID 142936511) is [(E)-hex-3-en-3-yl] 3-methoxybenzenecarboximidate.
What is the SMILES notation for [(E)-hex-3-en-3-yl] 3-methoxybenzenecarboximidate?
The canonical SMILES for [(E)-hex-3-en-3-yl] 3-methoxybenzenecarboximidate is [H]/N=C(\O/C(=C/CC)CC)c1cccc(OC)c1.
What is the InChIKey of [(E)-hex-3-en-3-yl] 3-methoxybenzenecarboximidate?
The InChIKey is YTADVUGITUKJSF-RQHVUCQOSA-N. The full InChI is InChI=1S/C14H19NO2/c1-4-7-12(5-2)17-14(15)11-8-6-9-13(10-11)16-3/h6-10,15H,4-5H2,1-3H3/b12-7+,15-14-.
What are the key properties of [(E)-hex-3-en-3-yl] 3-methoxybenzenecarboximidate?
[(E)-hex-3-en-3-yl] 3-methoxybenzenecarboximidate has a molecular weight of 233.31 g/mol, XLogP of 3.74, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-hex-3-en-3-yl] 3-methoxybenzenecarboximidate is sourced from PubChem (CID 142936511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).