About 2-phenylpropanimidoyl 3-methoxybenzenecarboximidate
2-phenylpropanimidoyl 3-methoxybenzenecarboximidate (PubChem CID 142004050) has the molecular formula C17H18N2O2
and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-phenylpropanimidoyl 3-methoxybenzenecarboximidate.
Molecular Properties
| Compound Name | 2-phenylpropanimidoyl 3-methoxybenzenecarboximidate |
| PubChem CID | 142004050 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-phenylpropanimidoyl 3-methoxybenzenecarboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])C(C)c1ccccc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C17H18N2O2/c1-12(13-7-4-3-5-8-13)16(18)21-17(19)14-9-6-10-15(11-14)20-2/h3-12,18-19H,1-2H3/b18-16+,19-17- |
| InChIKey | BQGKSKMOLULDTK-KZTQHSAISA-N |
| XLogP | 3.82 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylpropanimidoyl 3-methoxybenzenecarboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpropanimidoyl 3-methoxybenzenecarboximidate?
The IUPAC name of 2-phenylpropanimidoyl 3-methoxybenzenecarboximidate (CID 142004050) is 2-phenylpropanimidoyl 3-methoxybenzenecarboximidate.
What is the SMILES notation for 2-phenylpropanimidoyl 3-methoxybenzenecarboximidate?
The canonical SMILES for 2-phenylpropanimidoyl 3-methoxybenzenecarboximidate is [H]/N=C(\O/C(=N/[H])C(C)c1ccccc1)c1cccc(OC)c1.
What is the InChIKey of 2-phenylpropanimidoyl 3-methoxybenzenecarboximidate?
The InChIKey is BQGKSKMOLULDTK-KZTQHSAISA-N. The full InChI is InChI=1S/C17H18N2O2/c1-12(13-7-4-3-5-8-13)16(18)21-17(19)14-9-6-10-15(11-14)20-2/h3-12,18-19H,1-2H3/b18-16+,19-17-.
What are the key properties of 2-phenylpropanimidoyl 3-methoxybenzenecarboximidate?
2-phenylpropanimidoyl 3-methoxybenzenecarboximidate has a molecular weight of 282.34 g/mol, XLogP of 3.82, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpropanimidoyl 3-methoxybenzenecarboximidate is sourced from PubChem (CID 142004050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).