About (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate
(2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate (PubChem CID 173266229) has the molecular formula C20H30O3Si
and a molecular weight of 346.54 g/mol. Its IUPAC name is (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate.
Molecular Properties
| Compound Name | (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate |
| PubChem CID | 173266229 |
| Molecular Formula | C20H30O3Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate |
| SMILES | C=C[Si](CC)(CC)c1ccc(C(=O)OOC2CCCCC2C)cc1 |
| InChI | InChI=1S/C20H30O3Si/c1-5-24(6-2,7-3)18-14-12-17(13-15-18)20(21)23-22-19-11-9-8-10-16(19)4/h5,12-16,19H,1,6-11H2,2-4H3 |
| InChIKey | NSMXHBHMXBAFLN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate?
The IUPAC name of (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate (CID 173266229) is (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate.
What is the SMILES notation for (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate?
The canonical SMILES for (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate is C=C[Si](CC)(CC)c1ccc(C(=O)OOC2CCCCC2C)cc1.
What is the InChIKey of (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate?
The InChIKey is NSMXHBHMXBAFLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O3Si/c1-5-24(6-2,7-3)18-14-12-17(13-15-18)20(21)23-22-19-11-9-8-10-16(19)4/h5,12-16,19H,1,6-11H2,2-4H3.
What are the key properties of (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate?
(2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate has a molecular weight of 346.54 g/mol, XLogP of 4.77, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate is sourced from PubChem (CID 173266229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).