C20H30O3Si — CID 173266229
(2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate (PubChem CID 173266229) has the molecular formula C20H30O3Si and a molecular weight of 346.54 g/mol. Its IUPAC name is (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate.
| Compound Name | (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate |
|---|---|
| PubChem CID | 173266229 |
| Molecular Formula | C20H30O3Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (2-methylcyclohexyl) 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate |
| SMILES | C=C[Si](CC)(CC)c1ccc(C(=O)OOC2CCCCC2C)cc1 |
| InChI | InChI=1S/C20H30O3Si/c1-5-24(6-2,7-3)18-14-12-17(13-15-18)20(21)23-22-19-11-9-8-10-16(19)4/h5,12-16,19H,1,6-11H2,2-4H3 |
| InChIKey | NSMXHBHMXBAFLN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|