C21H32O3Si — CID 173267419
octyl 4-[bis(ethenyl)-ethylsilyl]benzenecarboperoxoate (PubChem CID 173267419) has the molecular formula C21H32O3Si and a molecular weight of 360.57 g/mol. Its IUPAC name is octyl 4-[bis(ethenyl)-ethylsilyl]benzenecarboperoxoate.
| Compound Name | octyl 4-[bis(ethenyl)-ethylsilyl]benzenecarboperoxoate |
|---|---|
| PubChem CID | 173267419 |
| Molecular Formula | C21H32O3Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | octyl 4-[bis(ethenyl)-ethylsilyl]benzenecarboperoxoate |
| SMILES | C=C[Si](C=C)(CC)c1ccc(C(=O)OOCCCCCCCC)cc1 |
| InChI | InChI=1S/C21H32O3Si/c1-5-9-10-11-12-13-18-23-24-21(22)19-14-16-20(17-15-19)25(6-2,7-3)8-4/h6-7,14-17H,2-3,5,8-13,18H2,1,4H3 |
| InChIKey | BZPRMSIVFLWVOG-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|