C19H28O3Si — CID 173267977
hexyl 4-[bis(ethenyl)-ethylsilyl]benzenecarboperoxoate (PubChem CID 173267977) has the molecular formula C19H28O3Si and a molecular weight of 332.52 g/mol. Its IUPAC name is hexyl 4-[bis(ethenyl)-ethylsilyl]benzenecarboperoxoate.
| Compound Name | hexyl 4-[bis(ethenyl)-ethylsilyl]benzenecarboperoxoate |
|---|---|
| PubChem CID | 173267977 |
| Molecular Formula | C19H28O3Si |
| Molecular Weight | 332.52 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | hexyl 4-[bis(ethenyl)-ethylsilyl]benzenecarboperoxoate |
| SMILES | C=C[Si](C=C)(CC)c1ccc(C(=O)OOCCCCCC)cc1 |
| InChI | InChI=1S/C19H28O3Si/c1-5-9-10-11-16-21-22-19(20)17-12-14-18(15-13-17)23(6-2,7-3)8-4/h6-7,12-15H,2-3,5,8-11,16H2,1,4H3 |
| InChIKey | LDYLVCBJEDUAOX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|