C15H22O3Si — CID 173267153
ethyl 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate (PubChem CID 173267153) has the molecular formula C15H22O3Si and a molecular weight of 278.42 g/mol. Its IUPAC name is ethyl 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate.
| Compound Name | ethyl 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate |
|---|---|
| PubChem CID | 173267153 |
| Molecular Formula | C15H22O3Si |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | ethyl 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate |
| SMILES | C=C[Si](CC)(CC)c1ccc(C(=O)OOCC)cc1 |
| InChI | InChI=1S/C15H22O3Si/c1-5-17-18-15(16)13-9-11-14(12-10-13)19(6-2,7-3)8-4/h6,9-12H,2,5,7-8H2,1,3-4H3 |
| InChIKey | PCGOKGRBRPZHSB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|