C18H28O4Si — CID 173267497
3-methoxybutyl 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate (PubChem CID 173267497) has the molecular formula C18H28O4Si and a molecular weight of 336.50 g/mol. Its IUPAC name is 3-methoxybutyl 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate.
| Compound Name | 3-methoxybutyl 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate |
|---|---|
| PubChem CID | 173267497 |
| Molecular Formula | C18H28O4Si |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-methoxybutyl 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate |
| SMILES | C=C[Si](CC)(CC)c1ccc(C(=O)OOCCC(C)OC)cc1 |
| InChI | InChI=1S/C18H28O4Si/c1-6-23(7-2,8-3)17-11-9-16(10-12-17)18(19)22-21-14-13-15(4)20-5/h6,9-12,15H,1,7-8,13-14H2,2-5H3 |
| InChIKey | MTUUBICCQWQKSA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|