C14H20O6 — CID 173267382
3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate (PubChem CID 173267382) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate.
| Compound Name | 3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate |
|---|---|
| PubChem CID | 173267382 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate |
| SMILES | COc1cccc(OC)c1C(=O)OOCCC(C)OC |
| InChI | InChI=1S/C14H20O6/c1-10(16-2)8-9-19-20-14(15)13-11(17-3)6-5-7-12(13)18-4/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | DFEJJRJXWJIFKW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|