3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate

C14H20O6 — CID 173267382

IUPAC3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate
SMILESCOc1cccc(OC)c1C(=O)OOCCC(C)OC
InChIInChI=1S/C14H20O6/c1-10(16-2)8-9-19-20-14(15)13-11(17-3)6-5-7-12(13)18-4/h5-7,10H,8-9H2,1-4H3
InChIKeyDFEJJRJXWJIFKW-UHFFFAOYSA-N
MW284.31 g/mol
LogP2.22
Rot. Bonds8

About 3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate

3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate (PubChem CID 173267382) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate.

Molecular Properties

Compound Name3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate
PubChem CID173267382
Molecular FormulaC14H20O6
Molecular Weight284.31 g/mol
Exact Mass284.13
IUPAC Name3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate
SMILESCOc1cccc(OC)c1C(=O)OOCCC(C)OC
InChIInChI=1S/C14H20O6/c1-10(16-2)8-9-19-20-14(15)13-11(17-3)6-5-7-12(13)18-4/h5-7,10H,8-9H2,1-4H3
InChIKeyDFEJJRJXWJIFKW-UHFFFAOYSA-N
XLogP2.22
TPSA63.22 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.31
LogP ≤ 52.22
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze 3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate?
The IUPAC name of 3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate (CID 173267382) is 3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate.
What is the SMILES notation for 3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate?
The canonical SMILES for 3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate is COc1cccc(OC)c1C(=O)OOCCC(C)OC.
What is the InChIKey of 3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate?
The InChIKey is DFEJJRJXWJIFKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O6/c1-10(16-2)8-9-19-20-14(15)13-11(17-3)6-5-7-12(13)18-4/h5-7,10H,8-9H2,1-4H3.
What are the key properties of 3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate?
3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate has a molecular weight of 284.31 g/mol, XLogP of 2.22, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxybutyl 2,6-dimethoxybenzenecarboperoxoate is sourced from PubChem (CID 173267382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).