C14H20O4 — CID 105134620
1-(2,6-dimethoxyphenyl)-4-methoxypentan-1-one (PubChem CID 105134620) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-4-methoxypentan-1-one.
| Compound Name | 1-(2,6-dimethoxyphenyl)-4-methoxypentan-1-one |
|---|---|
| PubChem CID | 105134620 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-4-methoxypentan-1-one |
| SMILES | COc1cccc(OC)c1C(=O)CCC(C)OC |
| InChI | InChI=1S/C14H20O4/c1-10(16-2)8-9-11(15)14-12(17-3)6-5-7-13(14)18-4/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | HYMDQAUKAGGGIZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |