C26H35O6P — CID 174920607
1,7-bis(2,6-dimethoxyphenyl)-3,5,5-trimethyl-2-phosphanylheptane-1,7-dione (PubChem CID 174920607) has the molecular formula C26H35O6P and a molecular weight of 474.53 g/mol. Its IUPAC name is 1,7-bis(2,6-dimethoxyphenyl)-3,5,5-trimethyl-2-phosphanylheptane-1,7-dione.
| Compound Name | 1,7-bis(2,6-dimethoxyphenyl)-3,5,5-trimethyl-2-phosphanylheptane-1,7-dione |
|---|---|
| PubChem CID | 174920607 |
| Molecular Formula | C26H35O6P |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 1,7-bis(2,6-dimethoxyphenyl)-3,5,5-trimethyl-2-phosphanylheptane-1,7-dione |
| SMILES | COc1cccc(OC)c1C(=O)CC(C)(C)CC(C)C(P)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C26H35O6P/c1-16(25(33)24(28)23-20(31-6)12-9-13-21(23)32-7)14-26(2,3)15-17(27)22-18(29-4)10-8-11-19(22)30-5/h8-13,16,25H,14-15,33H2,1-7H3 |
| InChIKey | FKXDMEFFLQZFOV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|