C17H23O4P — CID 175264665
1-(2,6-dimethoxyphenyl)-3,3,5-trimethyl-6-phosphorosohex-5-en-1-one (PubChem CID 175264665) has the molecular formula C17H23O4P and a molecular weight of 322.34 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-3,3,5-trimethyl-6-phosphorosohex-5-en-1-one.
| Compound Name | 1-(2,6-dimethoxyphenyl)-3,3,5-trimethyl-6-phosphorosohex-5-en-1-one |
|---|---|
| PubChem CID | 175264665 |
| Molecular Formula | C17H23O4P |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-3,3,5-trimethyl-6-phosphorosohex-5-en-1-one |
| SMILES | COc1cccc(OC)c1C(=O)CC(C)(C)CC(C)=CP=O |
| InChI | InChI=1S/C17H23O4P/c1-12(11-22-19)9-17(2,3)10-13(18)16-14(20-4)7-6-8-15(16)21-5/h6-8,11H,9-10H2,1-5H3 |
| InChIKey | FWOMRNYSQCHBJH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|