C23H30O4P+ — CID 170170683
[6-(2,6-dimethoxyphenyl)-2,4,4-trimethyl-6-oxohexyl]-oxo-phenylphosphanium (PubChem CID 170170683) has the molecular formula C23H30O4P+ and a molecular weight of 401.46 g/mol. Its IUPAC name is [6-(2,6-dimethoxyphenyl)-2,4,4-trimethyl-6-oxohexyl]-oxo-phenylphosphanium.
| Compound Name | [6-(2,6-dimethoxyphenyl)-2,4,4-trimethyl-6-oxohexyl]-oxo-phenylphosphanium |
|---|---|
| PubChem CID | 170170683 |
| Molecular Formula | C23H30O4P+ |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | [6-(2,6-dimethoxyphenyl)-2,4,4-trimethyl-6-oxohexyl]-oxo-phenylphosphanium |
| SMILES | COc1cccc(OC)c1C(=O)CC(C)(C)CC(C)C[P+](=O)c1ccccc1 |
| InChI | InChI=1S/C23H30O4P/c1-17(16-28(25)18-10-7-6-8-11-18)14-23(2,3)15-19(24)22-20(26-4)12-9-13-21(22)27-5/h6-13,17H,14-16H2,1-5H3/q+1 |
| InChIKey | PEQWVMQPIDNVMK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|