C19H30O4P+ — CID 66893194
(2,6-diethoxybenzoyl)-oxo-(2,4,4-trimethylpentyl)phosphanium (PubChem CID 66893194) has the molecular formula C19H30O4P+ and a molecular weight of 353.42 g/mol. Its IUPAC name is (2,6-diethoxybenzoyl)-oxo-(2,4,4-trimethylpentyl)phosphanium.
| Compound Name | (2,6-diethoxybenzoyl)-oxo-(2,4,4-trimethylpentyl)phosphanium |
|---|---|
| PubChem CID | 66893194 |
| Molecular Formula | C19H30O4P+ |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | (2,6-diethoxybenzoyl)-oxo-(2,4,4-trimethylpentyl)phosphanium |
| SMILES | CCOc1cccc(OCC)c1C(=O)[P+](=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C19H30O4P/c1-7-22-15-10-9-11-16(23-8-2)17(15)18(20)24(21)13-14(3)12-19(4,5)6/h9-11,14H,7-8,12-13H2,1-6H3/q+1 |
| InChIKey | QNLCVVXRFXUTLU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|