C15H23NO3 — CID 81414040
3,3-dimethylbutyl 2-amino-6-ethoxybenzoate (PubChem CID 81414040) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 3,3-dimethylbutyl 2-amino-6-ethoxybenzoate.
| Compound Name | 3,3-dimethylbutyl 2-amino-6-ethoxybenzoate |
|---|---|
| PubChem CID | 81414040 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 3,3-dimethylbutyl 2-amino-6-ethoxybenzoate |
| SMILES | CCOc1cccc(N)c1C(=O)OCCC(C)(C)C |
| InChI | InChI=1S/C15H23NO3/c1-5-18-12-8-6-7-11(16)13(12)14(17)19-10-9-15(2,3)4/h6-8H,5,9-10,16H2,1-4H3 |
| InChIKey | UFNBXXNKBLMYQL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|