About [2-(diethylamino)-2-oxoethyl] 2-amino-6-ethoxybenzoate
[2-(diethylamino)-2-oxoethyl] 2-amino-6-ethoxybenzoate (PubChem CID 81394370) has the molecular formula C15H22N2O4
and a molecular weight of 294.35 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] 2-amino-6-ethoxybenzoate.
Molecular Properties
| Compound Name | [2-(diethylamino)-2-oxoethyl] 2-amino-6-ethoxybenzoate |
| PubChem CID | 81394370 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] 2-amino-6-ethoxybenzoate |
| SMILES | CCOc1cccc(N)c1C(=O)OCC(=O)N(CC)CC |
| InChI | InChI=1S/C15H22N2O4/c1-4-17(5-2)13(18)10-21-15(19)14-11(16)8-7-9-12(14)20-6-3/h7-9H,4-6,10,16H2,1-3H3 |
| InChIKey | OVLVPGZPMDZZHF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [2-(diethylamino)-2-oxoethyl] 2-amino-6-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(diethylamino)-2-oxoethyl] 2-amino-6-ethoxybenzoate?
The IUPAC name of [2-(diethylamino)-2-oxoethyl] 2-amino-6-ethoxybenzoate (CID 81394370) is [2-(diethylamino)-2-oxoethyl] 2-amino-6-ethoxybenzoate.
What is the SMILES notation for [2-(diethylamino)-2-oxoethyl] 2-amino-6-ethoxybenzoate?
The canonical SMILES for [2-(diethylamino)-2-oxoethyl] 2-amino-6-ethoxybenzoate is CCOc1cccc(N)c1C(=O)OCC(=O)N(CC)CC.
What is the InChIKey of [2-(diethylamino)-2-oxoethyl] 2-amino-6-ethoxybenzoate?
The InChIKey is OVLVPGZPMDZZHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O4/c1-4-17(5-2)13(18)10-21-15(19)14-11(16)8-7-9-12(14)20-6-3/h7-9H,4-6,10,16H2,1-3H3.
What are the key properties of [2-(diethylamino)-2-oxoethyl] 2-amino-6-ethoxybenzoate?
[2-(diethylamino)-2-oxoethyl] 2-amino-6-ethoxybenzoate has a molecular weight of 294.35 g/mol, XLogP of 1.69, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(diethylamino)-2-oxoethyl] 2-amino-6-ethoxybenzoate is sourced from PubChem (CID 81394370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).