C32H42O5P+ — CID 159660943
[2,3-bis[(2,6-dimethoxyphenyl)methyl]phenyl]-oxo-(2,4,4-trimethylpentyl)phosphanium (PubChem CID 159660943) has the molecular formula C32H42O5P+ and a molecular weight of 537.66 g/mol. Its IUPAC name is [2,3-bis[(2,6-dimethoxyphenyl)methyl]phenyl]-oxo-(2,4,4-trimethylpentyl)phosphanium.
| Compound Name | [2,3-bis[(2,6-dimethoxyphenyl)methyl]phenyl]-oxo-(2,4,4-trimethylpentyl)phosphanium |
|---|---|
| PubChem CID | 159660943 |
| Molecular Formula | C32H42O5P+ |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | [2,3-bis[(2,6-dimethoxyphenyl)methyl]phenyl]-oxo-(2,4,4-trimethylpentyl)phosphanium |
| SMILES | COc1cccc(OC)c1Cc1cccc([P+](=O)CC(C)CC(C)(C)C)c1Cc1c(OC)cccc1OC |
| InChI | InChI=1S/C32H42O5P/c1-22(20-32(2,3)4)21-38(33)31-17-9-12-23(18-25-27(34-5)13-10-14-28(25)35-6)24(31)19-26-29(36-7)15-11-16-30(26)37-8/h9-17,22H,18-21H2,1-8H3/q+1 |
| InChIKey | QLEWHMKVIOHTNS-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|