C19H27O8P — CID 87923377
2-methoxyethyl 3-(2,6-dimethoxybenzoyl)-2,4-dimethyl-2-phosphorosopentaneperoxoate (PubChem CID 87923377) has the molecular formula C19H27O8P and a molecular weight of 414.39 g/mol. Its IUPAC name is 2-methoxyethyl 3-(2,6-dimethoxybenzoyl)-2,4-dimethyl-2-phosphorosopentaneperoxoate.
| Compound Name | 2-methoxyethyl 3-(2,6-dimethoxybenzoyl)-2,4-dimethyl-2-phosphorosopentaneperoxoate |
|---|---|
| PubChem CID | 87923377 |
| Molecular Formula | C19H27O8P |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-methoxyethyl 3-(2,6-dimethoxybenzoyl)-2,4-dimethyl-2-phosphorosopentaneperoxoate |
| SMILES | COCCOOC(=O)C(C)(P=O)C(C(=O)c1c(OC)cccc1OC)C(C)C |
| InChI | InChI=1S/C19H27O8P/c1-12(2)16(19(3,28-22)18(21)27-26-11-10-23-4)17(20)15-13(24-5)8-7-9-14(15)25-6/h7-9,12,16H,10-11H2,1-6H3 |
| InChIKey | HIFAQZDAHMMDLD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|