C20H27O8P — CID 87923354
2-methoxyethyl 2-[1-(2,6-dimethoxybenzoyl)cyclopentyl]-2-phosphorosopropaneperoxoate (PubChem CID 87923354) has the molecular formula C20H27O8P and a molecular weight of 426.40 g/mol. Its IUPAC name is 2-methoxyethyl 2-[1-(2,6-dimethoxybenzoyl)cyclopentyl]-2-phosphorosopropaneperoxoate.
| Compound Name | 2-methoxyethyl 2-[1-(2,6-dimethoxybenzoyl)cyclopentyl]-2-phosphorosopropaneperoxoate |
|---|---|
| PubChem CID | 87923354 |
| Molecular Formula | C20H27O8P |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-methoxyethyl 2-[1-(2,6-dimethoxybenzoyl)cyclopentyl]-2-phosphorosopropaneperoxoate |
| SMILES | COCCOOC(=O)C(C)(P=O)C1(C(=O)c2c(OC)cccc2OC)CCCC1 |
| InChI | InChI=1S/C20H27O8P/c1-19(29-23,18(22)28-27-13-12-24-2)20(10-5-6-11-20)17(21)16-14(25-3)8-7-9-15(16)26-4/h7-9H,5-6,10-13H2,1-4H3 |
| InChIKey | TUTCWFVTMPXBLN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|