C23H36O4Si — CID 173267997
2-(2-ethylhexoxy)ethyl 4-[bis(ethenyl)-ethylsilyl]benzenecarboperoxoate (PubChem CID 173267997) has the molecular formula C23H36O4Si and a molecular weight of 404.62 g/mol. Its IUPAC name is 2-(2-ethylhexoxy)ethyl 4-[bis(ethenyl)-ethylsilyl]benzenecarboperoxoate.
| Compound Name | 2-(2-ethylhexoxy)ethyl 4-[bis(ethenyl)-ethylsilyl]benzenecarboperoxoate |
|---|---|
| PubChem CID | 173267997 |
| Molecular Formula | C23H36O4Si |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 2-(2-ethylhexoxy)ethyl 4-[bis(ethenyl)-ethylsilyl]benzenecarboperoxoate |
| SMILES | C=C[Si](C=C)(CC)c1ccc(C(=O)OOCCOCC(CC)CCCC)cc1 |
| InChI | InChI=1S/C23H36O4Si/c1-6-11-12-20(7-2)19-25-17-18-26-27-23(24)21-13-15-22(16-14-21)28(8-3,9-4)10-5/h8-9,13-16,20H,3-4,6-7,10-12,17-19H2,1-2,5H3 |
| InChIKey | LIYJADBNAGBTFK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|