C20H32O3Si — CID 173267843
heptyl 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate (PubChem CID 173267843) has the molecular formula C20H32O3Si and a molecular weight of 348.56 g/mol. Its IUPAC name is heptyl 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate.
| Compound Name | heptyl 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate |
|---|---|
| PubChem CID | 173267843 |
| Molecular Formula | C20H32O3Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | heptyl 4-[ethenyl(diethyl)silyl]benzenecarboperoxoate |
| SMILES | C=C[Si](CC)(CC)c1ccc(C(=O)OOCCCCCCC)cc1 |
| InChI | InChI=1S/C20H32O3Si/c1-5-9-10-11-12-17-22-23-20(21)18-13-15-19(16-14-18)24(6-2,7-3)8-4/h6,13-16H,2,5,7-12,17H2,1,3-4H3 |
| InChIKey | QPAJRWVCSAWJTG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|