C25H26O13 — CID 139633645
diethyl 4-[3,4-bis(ethylperoxycarbonyl)benzoyl]benzene-1,2-dicarboperoxoate (PubChem CID 139633645) has the molecular formula C25H26O13 and a molecular weight of 534.47 g/mol. Its IUPAC name is diethyl 4-[3,4-bis(ethylperoxycarbonyl)benzoyl]benzene-1,2-dicarboperoxoate.
| Compound Name | diethyl 4-[3,4-bis(ethylperoxycarbonyl)benzoyl]benzene-1,2-dicarboperoxoate |
|---|---|
| PubChem CID | 139633645 |
| Molecular Formula | C25H26O13 |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | diethyl 4-[3,4-bis(ethylperoxycarbonyl)benzoyl]benzene-1,2-dicarboperoxoate |
| SMILES | CCOOC(=O)c1ccc(C(=O)c2ccc(C(=O)OOCC)c(C(=O)OOCC)c2)cc1C(=O)OOCC |
| InChI | InChI=1S/C25H26O13/c1-5-31-35-22(27)17-11-9-15(13-19(17)24(29)37-33-7-3)21(26)16-10-12-18(23(28)36-32-6-2)20(14-16)25(30)38-34-8-4/h9-14H,5-8H2,1-4H3 |
| InChIKey | NPUUWUZMYRKGGA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|