About ethyl 4-ethylperoxycarbonyl-2,5-dihydroxybenzoate
ethyl 4-ethylperoxycarbonyl-2,5-dihydroxybenzoate (PubChem CID 21031386) has the molecular formula C12H14O7
and a molecular weight of 270.24 g/mol. Its IUPAC name is ethyl 4-ethylperoxycarbonyl-2,5-dihydroxybenzoate.
Molecular Properties
| Compound Name | ethyl 4-ethylperoxycarbonyl-2,5-dihydroxybenzoate |
| PubChem CID | 21031386 |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | ethyl 4-ethylperoxycarbonyl-2,5-dihydroxybenzoate |
| SMILES | CCOOC(=O)c1cc(O)c(C(=O)OCC)cc1O |
| InChI | InChI=1S/C12H14O7/c1-3-17-11(15)7-5-10(14)8(6-9(7)13)12(16)19-18-4-2/h5-6,13-14H,3-4H2,1-2H3 |
| InChIKey | OANIAHJTYGHFEY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-ethylperoxycarbonyl-2,5-dihydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-ethylperoxycarbonyl-2,5-dihydroxybenzoate?
The IUPAC name of ethyl 4-ethylperoxycarbonyl-2,5-dihydroxybenzoate (CID 21031386) is ethyl 4-ethylperoxycarbonyl-2,5-dihydroxybenzoate.
What is the SMILES notation for ethyl 4-ethylperoxycarbonyl-2,5-dihydroxybenzoate?
The canonical SMILES for ethyl 4-ethylperoxycarbonyl-2,5-dihydroxybenzoate is CCOOC(=O)c1cc(O)c(C(=O)OCC)cc1O.
What is the InChIKey of ethyl 4-ethylperoxycarbonyl-2,5-dihydroxybenzoate?
The InChIKey is OANIAHJTYGHFEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O7/c1-3-17-11(15)7-5-10(14)8(6-9(7)13)12(16)19-18-4-2/h5-6,13-14H,3-4H2,1-2H3.
What are the key properties of ethyl 4-ethylperoxycarbonyl-2,5-dihydroxybenzoate?
ethyl 4-ethylperoxycarbonyl-2,5-dihydroxybenzoate has a molecular weight of 270.24 g/mol, XLogP of 1.38, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-ethylperoxycarbonyl-2,5-dihydroxybenzoate is sourced from PubChem (CID 21031386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).