C28H36O6 — CID 173266514
[2-(4-tert-butylbenzoyl)peroxycyclohexyl] 4-tert-butylbenzenecarboperoxoate (PubChem CID 173266514) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is [2-(4-tert-butylbenzoyl)peroxycyclohexyl] 4-tert-butylbenzenecarboperoxoate.
| Compound Name | [2-(4-tert-butylbenzoyl)peroxycyclohexyl] 4-tert-butylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173266514 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [2-(4-tert-butylbenzoyl)peroxycyclohexyl] 4-tert-butylbenzenecarboperoxoate |
| SMILES | CC(C)(C)c1ccc(C(=O)OOC2CCCCC2OOC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H36O6/c1-27(2,3)21-15-11-19(12-16-21)25(29)33-31-23-9-7-8-10-24(23)32-34-26(30)20-13-17-22(18-14-20)28(4,5)6/h11-18,23-24H,7-10H2,1-6H3 |
| InChIKey | HVAZSHBEDVIBBP-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|