C30H40O6 — CID 173265570
[2-(4-tert-butylbenzoyl)peroxy-2,5-dimethylcyclohexyl] 4-tert-butylbenzenecarboperoxoate (PubChem CID 173265570) has the molecular formula C30H40O6 and a molecular weight of 496.64 g/mol. Its IUPAC name is [2-(4-tert-butylbenzoyl)peroxy-2,5-dimethylcyclohexyl] 4-tert-butylbenzenecarboperoxoate.
| Compound Name | [2-(4-tert-butylbenzoyl)peroxy-2,5-dimethylcyclohexyl] 4-tert-butylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173265570 |
| Molecular Formula | C30H40O6 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | [2-(4-tert-butylbenzoyl)peroxy-2,5-dimethylcyclohexyl] 4-tert-butylbenzenecarboperoxoate |
| SMILES | CC1CCC(C)(OOC(=O)c2ccc(C(C)(C)C)cc2)C(OOC(=O)c2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C30H40O6/c1-20-17-18-30(8,36-35-27(32)22-11-15-24(16-12-22)29(5,6)7)25(19-20)33-34-26(31)21-9-13-23(14-10-21)28(2,3)4/h9-16,20,25H,17-19H2,1-8H3 |
| InChIKey | CEKKEBUZCZVDKY-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|