C34H32O6 — CID 173267930
[2,5-dimethyl-2-(3-phenylbenzoyl)peroxycyclohexyl] 3-phenylbenzenecarboperoxoate (PubChem CID 173267930) has the molecular formula C34H32O6 and a molecular weight of 536.62 g/mol. Its IUPAC name is [2,5-dimethyl-2-(3-phenylbenzoyl)peroxycyclohexyl] 3-phenylbenzenecarboperoxoate.
| Compound Name | [2,5-dimethyl-2-(3-phenylbenzoyl)peroxycyclohexyl] 3-phenylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173267930 |
| Molecular Formula | C34H32O6 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | [2,5-dimethyl-2-(3-phenylbenzoyl)peroxycyclohexyl] 3-phenylbenzenecarboperoxoate |
| SMILES | CC1CCC(C)(OOC(=O)c2cccc(-c3ccccc3)c2)C(OOC(=O)c2cccc(-c3ccccc3)c2)C1 |
| InChI | InChI=1S/C34H32O6/c1-24-19-20-34(2,40-39-33(36)30-18-10-16-28(23-30)26-13-7-4-8-14-26)31(21-24)37-38-32(35)29-17-9-15-27(22-29)25-11-5-3-6-12-25/h3-18,22-24,31H,19-21H2,1-2H3 |
| InChIKey | RSFGBHWHRVIKMG-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|