C18H26O3 — CID 173265840
(3,3,5-trimethylcyclohexyl) 4-ethylbenzenecarboperoxoate (PubChem CID 173265840) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (3,3,5-trimethylcyclohexyl) 4-ethylbenzenecarboperoxoate.
| Compound Name | (3,3,5-trimethylcyclohexyl) 4-ethylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173265840 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (3,3,5-trimethylcyclohexyl) 4-ethylbenzenecarboperoxoate |
| SMILES | CCc1ccc(C(=O)OOC2CC(C)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C18H26O3/c1-5-14-6-8-15(9-7-14)17(19)21-20-16-10-13(2)11-18(3,4)12-16/h6-9,13,16H,5,10-12H2,1-4H3 |
| InChIKey | IKKASHIFAJODIP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|