C25H40NO5+ — CID 7721942
methyl 4-[[4-[(2R)-2-hydroxy-3-[(1R,5S)-3,3,5-trimethylcyclohexyl]oxypropyl]morpholin-4-ium-4-yl]methyl]benzoate (PubChem CID 7721942) has the molecular formula C25H40NO5+ and a molecular weight of 434.60 g/mol. Its IUPAC name is methyl 4-[[4-[(2R)-2-hydroxy-3-[(1R,5S)-3,3,5-trimethylcyclohexyl]oxypropyl]morpholin-4-ium-4-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-[(2R)-2-hydroxy-3-[(1R,5S)-3,3,5-trimethylcyclohexyl]oxypropyl]morpholin-4-ium-4-yl]methyl]benzoate |
|---|---|
| PubChem CID | 7721942 |
| Molecular Formula | C25H40NO5+ |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | methyl 4-[[4-[(2R)-2-hydroxy-3-[(1R,5S)-3,3,5-trimethylcyclohexyl]oxypropyl]morpholin-4-ium-4-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C[N+]2(C[C@@H](O)CO[C@@H]3C[C@@H](C)CC(C)(C)C3)CCOCC2)cc1 |
| InChI | InChI=1S/C25H40NO5/c1-19-13-23(15-25(2,3)14-19)31-18-22(27)17-26(9-11-30-12-10-26)16-20-5-7-21(8-6-20)24(28)29-4/h5-8,19,22-23,27H,9-18H2,1-4H3/q+1/t19-,22-,23-/m1/s1 |
| InChIKey | JLNOGRALGSLJHB-UEVCKROQSA-N |
| XLogP | 3.41 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|