C20H38NO5+ — CID 26857231
ethyl 2-[4-[(2S)-2-hydroxy-3-[(1R,5S)-3,3,5-trimethylcyclohexyl]oxypropyl]morpholin-4-ium-4-yl]acetate (PubChem CID 26857231) has the molecular formula C20H38NO5+ and a molecular weight of 372.53 g/mol. Its IUPAC name is ethyl 2-[4-[(2S)-2-hydroxy-3-[(1R,5S)-3,3,5-trimethylcyclohexyl]oxypropyl]morpholin-4-ium-4-yl]acetate.
| Compound Name | ethyl 2-[4-[(2S)-2-hydroxy-3-[(1R,5S)-3,3,5-trimethylcyclohexyl]oxypropyl]morpholin-4-ium-4-yl]acetate |
|---|---|
| PubChem CID | 26857231 |
| Molecular Formula | C20H38NO5+ |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | ethyl 2-[4-[(2S)-2-hydroxy-3-[(1R,5S)-3,3,5-trimethylcyclohexyl]oxypropyl]morpholin-4-ium-4-yl]acetate |
| SMILES | CCOC(=O)C[N+]1(C[C@H](O)CO[C@@H]2C[C@@H](C)CC(C)(C)C2)CCOCC1 |
| InChI | InChI=1S/C20H38NO5/c1-5-25-19(23)14-21(6-8-24-9-7-21)13-17(22)15-26-18-10-16(2)11-20(3,4)12-18/h16-18,22H,5-15H2,1-4H3/q+1/t16-,17+,18-/m1/s1 |
| InChIKey | VGYXNZBNQHHMPC-FGTMMUONSA-N |
| XLogP | 1.99 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|