C18H36NO3+ — CID 7690014
(2S)-1-(4-ethylmorpholin-4-ium-4-yl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropan-2-ol (PubChem CID 7690014) has the molecular formula C18H36NO3+ and a molecular weight of 314.49 g/mol. Its IUPAC name is (2S)-1-(4-ethylmorpholin-4-ium-4-yl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropan-2-ol.
| Compound Name | (2S)-1-(4-ethylmorpholin-4-ium-4-yl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropan-2-ol |
|---|---|
| PubChem CID | 7690014 |
| Molecular Formula | C18H36NO3+ |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | (2S)-1-(4-ethylmorpholin-4-ium-4-yl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropan-2-ol |
| SMILES | CC[N+]1(C[C@H](O)CO[C@@H]2C[C@H](C)CC(C)(C)C2)CCOCC1 |
| InChI | InChI=1S/C18H36NO3/c1-5-19(6-8-21-9-7-19)13-16(20)14-22-17-10-15(2)11-18(3,4)12-17/h15-17,20H,5-14H2,1-4H3/q+1/t15-,16-,17+/m0/s1 |
| InChIKey | LDHSDHWSXOQHLI-YESZJQIVSA-N |
| XLogP | 2.45 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|