C17H34NO3+ — CID 7689979
(2R)-1-(4-methylmorpholin-4-ium-4-yl)-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]oxypropan-2-ol (PubChem CID 7689979) has the molecular formula C17H34NO3+ and a molecular weight of 300.46 g/mol. Its IUPAC name is (2R)-1-(4-methylmorpholin-4-ium-4-yl)-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]oxypropan-2-ol.
| Compound Name | (2R)-1-(4-methylmorpholin-4-ium-4-yl)-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]oxypropan-2-ol |
|---|---|
| PubChem CID | 7689979 |
| Molecular Formula | C17H34NO3+ |
| Molecular Weight | 300.46 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (2R)-1-(4-methylmorpholin-4-ium-4-yl)-3-[(1S,5S)-3,3,5-trimethylcyclohexyl]oxypropan-2-ol |
| SMILES | C[C@@H]1C[C@H](OC[C@H](O)C[N+]2(C)CCOCC2)CC(C)(C)C1 |
| InChI | InChI=1S/C17H34NO3/c1-14-9-16(11-17(2,3)10-14)21-13-15(19)12-18(4)5-7-20-8-6-18/h14-16,19H,5-13H2,1-4H3/q+1/t14-,15-,16+/m1/s1 |
| InChIKey | FDQUJFFWDKRYJR-OAGGEKHMSA-N |
| XLogP | 2.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|