C16H28O4 — CID 103484900
ethyl 4-oxo-5-(3,3,5-trimethylcyclohexyl)oxypentanoate (PubChem CID 103484900) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is ethyl 4-oxo-5-(3,3,5-trimethylcyclohexyl)oxypentanoate.
| Compound Name | ethyl 4-oxo-5-(3,3,5-trimethylcyclohexyl)oxypentanoate |
|---|---|
| PubChem CID | 103484900 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | ethyl 4-oxo-5-(3,3,5-trimethylcyclohexyl)oxypentanoate |
| SMILES | CCOC(=O)CCC(=O)COC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C16H28O4/c1-5-19-15(18)7-6-13(17)11-20-14-8-12(2)9-16(3,4)10-14/h12,14H,5-11H2,1-4H3 |
| InChIKey | OWQNTVMIXUEJCW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |