C17H29IO3 — CID 114773343
ethyl 3-iodo-4-(3,3,5-trimethylcyclohexyl)oxycyclopentane-1-carboxylate (PubChem CID 114773343) has the molecular formula C17H29IO3 and a molecular weight of 408.32 g/mol. Its IUPAC name is ethyl 3-iodo-4-(3,3,5-trimethylcyclohexyl)oxycyclopentane-1-carboxylate.
| Compound Name | ethyl 3-iodo-4-(3,3,5-trimethylcyclohexyl)oxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 114773343 |
| Molecular Formula | C17H29IO3 |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | ethyl 3-iodo-4-(3,3,5-trimethylcyclohexyl)oxycyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(I)C(OC2CC(C)CC(C)(C)C2)C1 |
| InChI | InChI=1S/C17H29IO3/c1-5-20-16(19)12-7-14(18)15(8-12)21-13-6-11(2)9-17(3,4)10-13/h11-15H,5-10H2,1-4H3 |
| InChIKey | VJJMIUYDQPIRSA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|