C15H25IO4 — CID 114775074
ethyl 3-(2,6-dimethyloxan-4-yl)oxy-4-iodocyclopentane-1-carboxylate (PubChem CID 114775074) has the molecular formula C15H25IO4 and a molecular weight of 396.27 g/mol. Its IUPAC name is ethyl 3-(2,6-dimethyloxan-4-yl)oxy-4-iodocyclopentane-1-carboxylate.
| Compound Name | ethyl 3-(2,6-dimethyloxan-4-yl)oxy-4-iodocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 114775074 |
| Molecular Formula | C15H25IO4 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | ethyl 3-(2,6-dimethyloxan-4-yl)oxy-4-iodocyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(I)C(OC2CC(C)OC(C)C2)C1 |
| InChI | InChI=1S/C15H25IO4/c1-4-18-15(17)11-7-13(16)14(8-11)20-12-5-9(2)19-10(3)6-12/h9-14H,4-8H2,1-3H3 |
| InChIKey | CPKJAKVFEUWJOU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|