C24H31ClNO4+ — CID 25316885
methyl 4-[[1-[(2S)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperidin-1-ium-1-yl]methyl]benzoate (PubChem CID 25316885) has the molecular formula C24H31ClNO4+ and a molecular weight of 432.97 g/mol. Its IUPAC name is methyl 4-[[1-[(2S)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperidin-1-ium-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[1-[(2S)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperidin-1-ium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 25316885 |
| Molecular Formula | C24H31ClNO4+ |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | methyl 4-[[1-[(2S)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]piperidin-1-ium-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C[N+]2(C[C@H](O)COCc3ccc(Cl)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C24H31ClNO4/c1-29-24(28)21-9-5-19(6-10-21)15-26(13-3-2-4-14-26)16-23(27)18-30-17-20-7-11-22(25)12-8-20/h5-12,23,27H,2-4,13-18H2,1H3/q+1/t23-/m0/s1 |
| InChIKey | GYDYTSXJLRRQGO-QHCPKHFHSA-N |
| XLogP | 4.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|