C21H30O3Si — CID 173267753
(3,3,5-trimethylcyclohexyl) 4-[bis(ethenyl)-methylsilyl]benzenecarboperoxoate (PubChem CID 173267753) has the molecular formula C21H30O3Si and a molecular weight of 358.55 g/mol. Its IUPAC name is (3,3,5-trimethylcyclohexyl) 4-[bis(ethenyl)-methylsilyl]benzenecarboperoxoate.
| Compound Name | (3,3,5-trimethylcyclohexyl) 4-[bis(ethenyl)-methylsilyl]benzenecarboperoxoate |
|---|---|
| PubChem CID | 173267753 |
| Molecular Formula | C21H30O3Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (3,3,5-trimethylcyclohexyl) 4-[bis(ethenyl)-methylsilyl]benzenecarboperoxoate |
| SMILES | C=C[Si](C)(C=C)c1ccc(C(=O)OOC2CC(C)CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C21H30O3Si/c1-7-25(6,8-2)19-11-9-17(10-12-19)20(22)24-23-18-13-16(3)14-21(4,5)15-18/h7-12,16,18H,1-2,13-15H2,3-6H3 |
| InChIKey | UWCTUTIFTOLDLB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|