C19H21O2P — CID 59129999
1-(4-tert-butylphenyl)-3-(4-phosphanylphenyl)propane-1,3-dione (PubChem CID 59129999) has the molecular formula C19H21O2P and a molecular weight of 312.35 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(4-phosphanylphenyl)propane-1,3-dione.
| Compound Name | 1-(4-tert-butylphenyl)-3-(4-phosphanylphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 59129999 |
| Molecular Formula | C19H21O2P |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(4-phosphanylphenyl)propane-1,3-dione |
| SMILES | CC(C)(C)c1ccc(C(=O)CC(=O)c2ccc(P)cc2)cc1 |
| InChI | InChI=1S/C19H21O2P/c1-19(2,3)15-8-4-13(5-9-15)17(20)12-18(21)14-6-10-16(22)11-7-14/h4-11H,12,22H2,1-3H3 |
| InChIKey | NKVIONXKBJQABA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|