C16H18 — CID 158122818
1-deuterio-4-[2-(4-methylphenyl)propan-2-yl]benzene (PubChem CID 158122818) has the molecular formula C16H18 and a molecular weight of 211.33 g/mol. Its IUPAC name is 1-deuterio-4-[2-(4-methylphenyl)propan-2-yl]benzene.
| Compound Name | 1-deuterio-4-[2-(4-methylphenyl)propan-2-yl]benzene |
|---|---|
| PubChem CID | 158122818 |
| Molecular Formula | C16H18 |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | 1-deuterio-4-[2-(4-methylphenyl)propan-2-yl]benzene |
| SMILES | [2H]c1ccc(C(C)(C)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C16H18/c1-13-9-11-15(12-10-13)16(2,3)14-7-5-4-6-8-14/h4-12H,1-3H3/i4D |
| InChIKey | NZQKAWXKMYCJDO-QYKNYGDISA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |